C32H28N4O6 — CID 11114449
(5S,15S)-5,15-dibenzyl-3,17-dioxa-6,14,23,24-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone (PubChem CID 11114449) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is (5S,15S)-5,15-dibenzyl-3,17-dioxa-6,14,23,24-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone.
| Compound Name | (5S,15S)-5,15-dibenzyl-3,17-dioxa-6,14,23,24-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
|---|---|
| PubChem CID | 11114449 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (5S,15S)-5,15-dibenzyl-3,17-dioxa-6,14,23,24-tetrazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
| SMILES | O=C1N[C@@H](Cc2ccccc2)COC(=O)c2cccc(n2)C(=O)OC[C@H](Cc2ccccc2)NC(=O)c2cccc1n2 |
| InChI | InChI=1S/C32H28N4O6/c37-29-25-13-7-14-26(35-25)30(38)34-24(18-22-11-5-2-6-12-22)20-42-32(40)28-16-8-15-27(36-28)31(39)41-19-23(33-29)17-21-9-3-1-4-10-21/h1-16,23-24H,17-20H2,(H,33,37)(H,34,38)/t23-,24-/m0/s1 |
| InChIKey | FZXZSMOWDAJWEB-ZEQRLZLVSA-N |
| XLogP | 3.19 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |