C23H40IN5 — CID 111145535
N-ethyl-3-methyl-N'-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111145535) has the molecular formula C23H40IN5 and a molecular weight of 513.51 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3-methyl-N'-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111145535 |
| Molecular Formula | C23H40IN5 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-ethyl-3-methyl-N'-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCN(C)CC2)cc1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C23H39N5.HI/c1-4-24-23(28-14-5-7-20(2)18-28)25-17-21-8-10-22(11-9-21)19-27-13-6-12-26(3)15-16-27;/h8-11,20H,4-7,12-19H2,1-3H3,(H,24,25);1H |
| InChIKey | RNOPOWIEQVTBFW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|