C15H32IN3O — CID 111145605
N',3-dimethyl-N-[2-(3-methylbutoxy)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111145605) has the molecular formula C15H32IN3O and a molecular weight of 397.35 g/mol. Its IUPAC name is N',3-dimethyl-N-[2-(3-methylbutoxy)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',3-dimethyl-N-[2-(3-methylbutoxy)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111145605 |
| Molecular Formula | C15H32IN3O |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N',3-dimethyl-N-[2-(3-methylbutoxy)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOCCC(C)C)N1CCCC(C)C1.I |
| InChI | InChI=1S/C15H31N3O.HI/c1-13(2)7-10-19-11-8-17-15(16-4)18-9-5-6-14(3)12-18;/h13-14H,5-12H2,1-4H3,(H,16,17);1H |
| InChIKey | ONLGDENAWQIWEF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|