C13H26IN3O2 — CID 111144955
methyl 2-methyl-3-[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]propanoate;hydroiodide (PubChem CID 111144955) has the molecular formula C13H26IN3O2 and a molecular weight of 383.27 g/mol. Its IUPAC name is methyl 2-methyl-3-[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 2-methyl-3-[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111144955 |
| Molecular Formula | C13H26IN3O2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 2-methyl-3-[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCC(C)C(=O)OC)N1CCCC(C)C1.I |
| InChI | InChI=1S/C13H25N3O2.HI/c1-10-6-5-7-16(9-10)13(14-3)15-8-11(2)12(17)18-4;/h10-11H,5-9H2,1-4H3,(H,14,15);1H |
| InChIKey | GIDROTOCZIXKBG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|