C13H25N3O2S — CID 109484742
methyl 3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-2-methylpropanoate (PubChem CID 109484742) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is methyl 3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 109484742 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | methyl 3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]-2-methylpropanoate |
| SMILES | CCC1CN(/C(=N/C)NCC(C)C(=O)OC)CCS1 |
| InChI | InChI=1S/C13H25N3O2S/c1-5-11-9-16(6-7-19-11)13(14-3)15-8-10(2)12(17)18-4/h10-11H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | BESMBWLWPSKNSH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|