C15H31IN4OS — CID 109484859
N-butan-2-yl-3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanamide;hydroiodide (PubChem CID 109484859) has the molecular formula C15H31IN4OS and a molecular weight of 442.41 g/mol. Its IUPAC name is N-butan-2-yl-3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109484859 |
| Molecular Formula | C15H31IN4OS |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-butan-2-yl-3-[[C-(2-ethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C15H30N4OS.HI/c1-5-12(3)18-14(20)7-8-17-15(16-4)19-9-10-21-13(6-2)11-19;/h12-13H,5-11H2,1-4H3,(H,16,17)(H,18,20);1H |
| InChIKey | FIUWTFDARIWSGI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|