C16H28F3N3O3 — CID 111155344
ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155344) has the molecular formula C16H28F3N3O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155344 |
| Molecular Formula | C16H28F3N3O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H28F3N3O3/c1-3-20-15(21-8-5-11-24-12-16(17,18)19)22-9-6-13(7-10-22)14(23)25-4-2/h13H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | PNGSETHTFNSTIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|