C40H66N10O2S4 — CID 11115545
13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazacyclooctacosane-2,10,16,24-tetrathione (PubChem CID 11115545) has the molecular formula C40H66N10O2S4 and a molecular weight of 847.30 g/mol. Its IUPAC name is 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazacyclooctacosane-2,10,16,24-tetrathione.
| Compound Name | 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazacyclooctacosane-2,10,16,24-tetrathione |
|---|---|
| PubChem CID | 11115545 |
| Molecular Formula | C40H66N10O2S4 |
| Molecular Weight | 847.30 g/mol |
| Exact Mass | 846.43 |
| IUPAC Name | 13,27-bis(4-phenylmethoxybutyl)-1,3,6,9,11,15,17,20,23,25-decazacyclooctacosane-2,10,16,24-tetrathione |
| SMILES | S=C1NCCNCCNC(=S)NCC(CCCCOCc2ccccc2)CNC(=S)NCCNCCNC(=S)NCC(CCCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C40H66N10O2S4/c53-37-43-21-17-41-19-23-45-39(55)49-29-36(16-8-10-26-52-32-34-13-5-2-6-14-34)30-50-40(56)46-24-20-42-18-22-44-38(54)48-28-35(27-47-37)15-7-9-25-51-31-33-11-3-1-4-12-33/h1-6,11-14,35-36,41-42H,7-10,15-32H2,(H2,43,47,53)(H2,44,48,54)(H2,45,49,55)(H2,46,50,56) |
| InChIKey | BWIZKHFCYRLTAC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|