C20H38N4O2 — CID 111157789
ethyl 1-[N-[3-[cyclohexyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111157789) has the molecular formula C20H38N4O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is ethyl 1-[N-[3-[cyclohexyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-[3-[cyclohexyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111157789 |
| Molecular Formula | C20H38N4O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | ethyl 1-[N-[3-[cyclohexyl(methyl)amino]propyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCCCN(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H38N4O2/c1-4-26-19(25)17-11-15-24(16-12-17)20(21-2)22-13-8-14-23(3)18-9-6-5-7-10-18/h17-18H,4-16H2,1-3H3,(H,21,22) |
| InChIKey | FJNKZWTUARTVEI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|