C13H29IN4O — CID 111158394
N-tert-butyl-2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]acetamide;hydroiodide (PubChem CID 111158394) has the molecular formula C13H29IN4O and a molecular weight of 384.31 g/mol. Its IUPAC name is N-tert-butyl-2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111158394 |
| Molecular Formula | C13H29IN4O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-tert-butyl-2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]acetamide;hydroiodide |
| SMILES | CCCCN(C)/C(=N/C)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C13H28N4O.HI/c1-7-8-9-17(6)12(14-5)15-10-11(18)16-13(2,3)4;/h7-10H2,1-6H3,(H,14,15)(H,16,18);1H |
| InChIKey | SIGYOKNQHDBJOT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|