C16H28N4O2S — CID 111158709
1-butyl-3-ethyl-1-methyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111158709) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-butyl-3-ethyl-1-methyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-butyl-3-ethyl-1-methyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111158709 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-butyl-3-ethyl-1-methyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CCCCN(C)/C(=N/Cc1ccc(S(=O)(=O)NC)cc1)NCC |
| InChI | InChI=1S/C16H28N4O2S/c1-5-7-12-20(4)16(18-6-2)19-13-14-8-10-15(11-9-14)23(21,22)17-3/h8-11,17H,5-7,12-13H2,1-4H3,(H,18,19) |
| InChIKey | WYTDTAZSSBUARR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|