C16H30IN5 — CID 111159082
1-butyl-2-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111159082) has the molecular formula C16H30IN5 and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-butyl-2-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-butyl-2-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111159082 |
| Molecular Formula | C16H30IN5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-butyl-2-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N/Cc1ccnc(N(C)C)c1)NCC.I |
| InChI | InChI=1S/C16H29N5.HI/c1-6-8-11-21(5)16(17-7-2)19-13-14-9-10-18-15(12-14)20(3)4;/h9-10,12H,6-8,11,13H2,1-5H3,(H,17,19);1H |
| InChIKey | SFDRRSGFXRPHEN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|