C17H27IN6 — CID 111158118
1-butyl-3-ethyl-1-methyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111158118) has the molecular formula C17H27IN6 and a molecular weight of 442.35 g/mol. Its IUPAC name is 1-butyl-3-ethyl-1-methyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-ethyl-1-methyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111158118 |
| Molecular Formula | C17H27IN6 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-butyl-3-ethyl-1-methyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N/Cc1ccnc(-n2cccn2)c1)NCC.I |
| InChI | InChI=1S/C17H26N6.HI/c1-4-6-11-22(3)17(18-5-2)20-14-15-8-10-19-16(13-15)23-12-7-9-21-23;/h7-10,12-13H,4-6,11,14H2,1-3H3,(H,18,20);1H |
| InChIKey | UBXYAPUEQNSLOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|