C22H37N3O2 — CID 111159549
1-butyl-3-ethyl-2-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-1-methylguanidine (PubChem CID 111159549) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-1-methylguanidine.
| Compound Name | 1-butyl-3-ethyl-2-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111159549 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 1-butyl-3-ethyl-2-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-1-methylguanidine |
| SMILES | CCCCN(C)/C(=N/CC1(c2cc(C)ccc2OC)CCOCC1)NCC |
| InChI | InChI=1S/C22H37N3O2/c1-6-8-13-25(4)21(23-7-2)24-17-22(11-14-27-15-12-22)19-16-18(3)9-10-20(19)26-5/h9-10,16H,6-8,11-15,17H2,1-5H3,(H,23,24) |
| InChIKey | GIXDTHBEYFBCML-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|