C25H44IN3O3 — CID 111716833
2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111716833) has the molecular formula C25H44IN3O3 and a molecular weight of 561.55 g/mol. Its IUPAC name is 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111716833 |
| Molecular Formula | C25H44IN3O3 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 2-(2,2-diethyl-4-hydroxybutyl)-1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)NCC1(c2cc(C)ccc2OC)CCOCC1.I |
| InChI | InChI=1S/C25H43N3O3.HI/c1-6-24(7-2,11-14-29)18-27-23(26-8-3)28-19-25(12-15-31-16-13-25)21-17-20(4)9-10-22(21)30-5;/h9-10,17,29H,6-8,11-16,18-19H2,1-5H3,(H2,26,27,28);1H |
| InChIKey | ITICDADLYNULFW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|