C24H33IN6O2 — CID 111013530
1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111013530) has the molecular formula C24H33IN6O2 and a molecular weight of 564.47 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013530 |
| Molecular Formula | C24H33IN6O2 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-ethyl-3-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC1(c2cc(C)ccc2OC)CCOCC1.I |
| InChI | InChI=1S/C24H32N6O2.HI/c1-4-25-23(26-16-22-29-28-21-7-5-6-12-30(21)22)27-17-24(10-13-32-14-11-24)19-15-18(2)8-9-20(19)31-3;/h5-9,12,15H,4,10-11,13-14,16-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | YPECOCYVYIAONK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|