C24H33N3O2 — CID 111359380
1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine (PubChem CID 111359380) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine.
| Compound Name | 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111359380 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1C)NCC1(c2cc(C)ccc2OC)CCOCC1 |
| InChI | InChI=1S/C24H33N3O2/c1-18-9-10-22(28-4)21(15-18)24(11-13-29-14-12-24)17-27-23(25-3)26-16-20-8-6-5-7-19(20)2/h5-10,15H,11-14,16-17H2,1-4H3,(H2,25,26,27) |
| InChIKey | BFYOWZXDQSNHQV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|