C24H40N4O3 — CID 111315720
1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111315720) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111315720 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 1-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | C/N=C(/NCC1(c2cc(C)ccc2OC)CCOCC1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C24H40N4O3/c1-19-6-7-21(29-5)20(16-19)24(8-12-30-13-9-24)18-27-22(25-4)26-17-23(2,3)28-10-14-31-15-11-28/h6-7,16H,8-15,17-18H2,1-5H3,(H2,25,26,27) |
| InChIKey | HEQLVYLBMHSBMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|