C13H30IN3O — CID 111161364
1-ethyl-3-hexyl-2-(3-hydroxy-2-methylpropyl)guanidine;hydroiodide (PubChem CID 111161364) has the molecular formula C13H30IN3O and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-ethyl-3-hexyl-2-(3-hydroxy-2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-hexyl-2-(3-hydroxy-2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111161364 |
| Molecular Formula | C13H30IN3O |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-ethyl-3-hexyl-2-(3-hydroxy-2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCCCCCN/C(=N/CC(C)CO)NCC.I |
| InChI | InChI=1S/C13H29N3O.HI/c1-4-6-7-8-9-15-13(14-5-2)16-10-12(3)11-17;/h12,17H,4-11H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | BVXBYRASQFZRHT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|