C7H11N3O — CID 11116254
1-(5-amino-1,3-dimethylpyrazol-4-yl)ethanone (PubChem CID 11116254) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-(5-amino-1,3-dimethylpyrazol-4-yl)ethanone.
| Compound Name | 1-(5-amino-1,3-dimethylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 11116254 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 1-(5-amino-1,3-dimethylpyrazol-4-yl)ethanone |
| SMILES | CC(=O)c1c(C)nn(C)c1N |
| InChI | InChI=1S/C7H11N3O/c1-4-6(5(2)11)7(8)10(3)9-4/h8H2,1-3H3 |
| InChIKey | SYAUYDVLRRJHKT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |