C8H8ClN3O — CID 137218174
6-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one (PubChem CID 137218174) has the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one.
| Compound Name | 6-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 137218174 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 6-chloro-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one |
| SMILES | Cc1nn(C)c2[nH]c(Cl)cc(=O)c12 |
| InChI | InChI=1S/C8H8ClN3O/c1-4-7-5(13)3-6(9)10-8(7)12(2)11-4/h3H,1-2H3,(H,10,13) |
| InChIKey | MYQAKDJIPSBOJQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|