C23H31FN6O — CID 111165947
N-ethyl-4-(4-fluorophenyl)-N'-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111165947) has the molecular formula C23H31FN6O and a molecular weight of 426.54 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165947 |
| Molecular Formula | C23H31FN6O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H31FN6O/c1-2-25-23(30-12-10-28(11-13-30)21-7-5-20(24)6-8-21)27-18-19-4-3-9-26-22(19)29-14-16-31-17-15-29/h3-9H,2,10-18H2,1H3,(H,25,27) |
| InChIKey | KPLCDEANOQTTEU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|