C23H32FIN4O — CID 111171648
1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111171648) has the molecular formula C23H32FIN4O and a molecular weight of 526.44 g/mol. Its IUPAC name is 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111171648 |
| Molecular Formula | C23H32FIN4O |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCOCC2)c(F)c1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C23H31FN4O.HI/c1-18(8-9-19-6-4-3-5-7-19)27-23(25-2)26-17-20-10-11-22(21(24)16-20)28-12-14-29-15-13-28;/h3-7,10-11,16,18H,8-9,12-15,17H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | RURRGKDHWVLZAA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|