C23H31IN4 — CID 111792842
1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111792842) has the molecular formula C23H31IN4 and a molecular weight of 490.43 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792842 |
| Molecular Formula | C23H31IN4 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CC=CC2)cc1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C23H30N4.HI/c1-19(10-11-20-8-4-3-5-9-20)26-23(24-2)25-18-21-12-14-22(15-13-21)27-16-6-7-17-27;/h3-9,12-15,19H,10-11,16-18H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XWVCDXVIVZWMJD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|