C20H33IN4 — CID 111793301
1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide (PubChem CID 111793301) has the molecular formula C20H33IN4 and a molecular weight of 456.42 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111793301 |
| Molecular Formula | C20H33IN4 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-heptan-2-yl-2-methylguanidine;hydroiodide |
| SMILES | CCCCCC(C)N/C(=N\C)NCc1ccc(N2CC=CC2)cc1.I |
| InChI | InChI=1S/C20H32N4.HI/c1-4-5-6-9-17(2)23-20(21-3)22-16-18-10-12-19(13-11-18)24-14-7-8-15-24;/h7-8,10-13,17H,4-6,9,14-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | CLOVHVOBFFJBFB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|