C17H19F3N2O3 — CID 1111751
1-[(3R,3aS)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-phenoxyethanone (PubChem CID 1111751) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-[(3R,3aS)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-phenoxyethanone.
| Compound Name | 1-[(3R,3aS)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 1111751 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(3R,3aS)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1N=C2CCCCC[C@@H]2[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N2O3/c18-17(19,20)16(24)13-9-5-2-6-10-14(13)21-22(16)15(23)11-25-12-7-3-1-4-8-12/h1,3-4,7-8,13,24H,2,5-6,9-11H2/t13-,16+/m0/s1 |
| InChIKey | PVYZUTMVPCMMJJ-XJKSGUPXSA-N |
| XLogP | 3.09 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |