C21H27F3N2O3 — CID 1278543
1-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-(4-tert-butylphenoxy)ethanone (PubChem CID 1278543) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-(4-tert-butylphenoxy)ethanone.
| Compound Name | 1-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-(4-tert-butylphenoxy)ethanone |
|---|---|
| PubChem CID | 1278543 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[(3R,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-2-(4-tert-butylphenoxy)ethanone |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N2N=C3CCCCC[C@H]3[C@@]2(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H27F3N2O3/c1-19(2,3)14-9-11-15(12-10-14)29-13-18(27)26-20(28,21(22,23)24)16-7-5-4-6-8-17(16)25-26/h9-12,16,28H,4-8,13H2,1-3H3/t16-,20-/m1/s1 |
| InChIKey | VOWUSRYWUSPFRA-OXQOHEQNSA-N |
| XLogP | 4.39 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |