C25H35F3N2O3 — CID 126358709
1-[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-tert-butylphenoxy)ethanone (PubChem CID 126358709) has the molecular formula C25H35F3N2O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-tert-butylphenoxy)ethanone.
| Compound Name | 1-[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-tert-butylphenoxy)ethanone |
|---|---|
| PubChem CID | 126358709 |
| Molecular Formula | C25H35F3N2O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-2-(4-tert-butylphenoxy)ethanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)COc3ccc(C(C)(C)C)cc3)[C@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C25H35F3N2O3/c1-7-23(5,6)17-10-13-20-19(14-17)24(32,25(26,27)28)30(29-20)21(31)15-33-18-11-8-16(9-12-18)22(2,3)4/h8-9,11-12,17,19,32H,7,10,13-15H2,1-6H3/t17-,19-,24-/m1/s1 |
| InChIKey | GMMGLDCWANPOHQ-ROMRWMGNSA-N |
| XLogP | 5.66 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |