C21H27F3N2O3 — CID 126347229
[(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 126347229) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 126347229 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [(3R,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)c3ccc(OC)cc3)[C@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C21H27F3N2O3/c1-5-19(2,3)14-8-11-17-16(12-14)20(28,21(22,23)24)26(25-17)18(27)13-6-9-15(29-4)10-7-13/h6-7,9-10,14,16,28H,5,8,11-12H2,1-4H3/t14-,16+,20-/m1/s1 |
| InChIKey | CZPGZAIVUHTCOX-PTSWNOGYSA-N |
| XLogP | 4.61 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |