C18H22F3N3O2 — CID 7111560
[(3R,3aS,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-[4-(dimethylamino)phenyl]methanone (PubChem CID 7111560) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is [(3R,3aS,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-[4-(dimethylamino)phenyl]methanone.
| Compound Name | [(3R,3aS,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 7111560 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(3R,3aS,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-[4-(dimethylamino)phenyl]methanone |
| SMILES | C[C@@H]1CCC2=NN(C(=O)c3ccc(N(C)C)cc3)[C@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-11-4-9-15-14(10-11)17(26,18(19,20)21)24(22-15)16(25)12-5-7-13(8-6-12)23(2)3/h5-8,11,14,26H,4,9-10H2,1-3H3/t11-,14+,17-/m1/s1 |
| InChIKey | DPWDQFFZSQUQCA-HYSWKAIVSA-N |
| XLogP | 3.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |