C16H17F3N2O2 — CID 92650683
[(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-phenylmethanone (PubChem CID 92650683) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-phenylmethanone.
| Compound Name | [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 92650683 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-phenylmethanone |
| SMILES | C[C@@H]1CCC2=NN(C(=O)c3ccccc3)[C@@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-10-7-8-13-12(9-10)15(23,16(17,18)19)21(20-13)14(22)11-5-3-2-4-6-11/h2-6,10,12,23H,7-9H2,1H3/t10-,12-,15+/m1/s1 |
| InChIKey | COBBJWJPCONBFQ-HCKVZZMMSA-N |
| XLogP | 3.19 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |