C14H15F3N2O3 — CID 6542780
[(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(furan-2-yl)methanone (PubChem CID 6542780) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 6542780 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [(3S,3aR,5R)-3-hydroxy-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(furan-2-yl)methanone |
| SMILES | C[C@@H]1CCC2=NN(C(=O)c3ccco3)[C@@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-8-4-5-10-9(7-8)13(21,14(15,16)17)19(18-10)12(20)11-3-2-6-22-11/h2-3,6,8-9,21H,4-5,7H2,1H3/t8-,9-,13+/m1/s1 |
| InChIKey | WWMBCTJTJQTNDI-KKFJDGPESA-N |
| XLogP | 2.78 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |