C16H16F3N3OS — CID 124826915
(3S,3aS,5R)-2-(1,3-benzothiazol-2-yl)-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol (PubChem CID 124826915) has the molecular formula C16H16F3N3OS and a molecular weight of 355.39 g/mol. Its IUPAC name is (3S,3aS,5R)-2-(1,3-benzothiazol-2-yl)-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol.
| Compound Name | (3S,3aS,5R)-2-(1,3-benzothiazol-2-yl)-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
|---|---|
| PubChem CID | 124826915 |
| Molecular Formula | C16H16F3N3OS |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (3S,3aS,5R)-2-(1,3-benzothiazol-2-yl)-5-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
| SMILES | C[C@@H]1CCC2=NN(c3nc4ccccc4s3)[C@@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C16H16F3N3OS/c1-9-6-7-11-10(8-9)15(23,16(17,18)19)22(21-11)14-20-12-4-2-3-5-13(12)24-14/h2-5,9-10,23H,6-8H2,1H3/t9-,10+,15+/m1/s1 |
| InChIKey | BAGPJGSPOHTGMQ-FTGAXOIBSA-N |
| XLogP | 4.16 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |