C20H22F3N3O2S — CID 92525361
(3R,3aR,5S)-5-ethyl-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol (PubChem CID 92525361) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is (3R,3aR,5S)-5-ethyl-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol.
| Compound Name | (3R,3aR,5S)-5-ethyl-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
|---|---|
| PubChem CID | 92525361 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3R,3aR,5S)-5-ethyl-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
| SMILES | CC[C@H]1CCC2=NN(c3nc(-c4ccc(OC)cc4)cs3)[C@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C20H22F3N3O2S/c1-3-12-4-9-16-15(10-12)19(27,20(21,22)23)26(25-16)18-24-17(11-29-18)13-5-7-14(28-2)8-6-13/h5-8,11-12,15,27H,3-4,9-10H2,1-2H3/t12-,15+,19+/m0/s1 |
| InChIKey | VJMQHCUMDADTEK-IOHHAYIISA-N |
| XLogP | 5.07 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |