C24H22F3N3O2S — CID 124770017
(3S,3aR,5S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol (PubChem CID 124770017) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is (3S,3aR,5S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol.
| Compound Name | (3S,3aR,5S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
|---|---|
| PubChem CID | 124770017 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (3S,3aR,5S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-3-ol |
| SMILES | COc1ccc(-c2csc(N3N=C4CC[C@H](c5ccccc5)C[C@H]4[C@]3(O)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C24H22F3N3O2S/c1-32-18-10-7-16(8-11-18)21-14-33-22(28-21)30-23(31,24(25,26)27)19-13-17(9-12-20(19)29-30)15-5-3-2-4-6-15/h2-8,10-11,14,17,19,31H,9,12-13H2,1H3/t17-,19+,23-/m0/s1 |
| InChIKey | PMPAMSURRMCKHB-GWJPWWOOSA-N |
| XLogP | 5.83 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |