C20H24F4N2O2 — CID 126366572
[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-fluorophenyl)methanone (PubChem CID 126366572) has the molecular formula C20H24F4N2O2 and a molecular weight of 400.42 g/mol. Its IUPAC name is [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 126366572 |
| Molecular Formula | C20H24F4N2O2 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-fluorophenyl)methanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)c3ccc(F)cc3)[C@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C20H24F4N2O2/c1-4-18(2,3)13-7-10-16-15(11-13)19(28,20(22,23)24)26(25-16)17(27)12-5-8-14(21)9-6-12/h5-6,8-9,13,15,28H,4,7,10-11H2,1-3H3/t13-,15-,19-/m1/s1 |
| InChIKey | QNYPJNOBWUNBNA-ZXYWRSMDSA-N |
| XLogP | 4.74 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |