C20H24F3N3O4 — CID 126360741
[(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(3-nitrophenyl)methanone (PubChem CID 126360741) has the molecular formula C20H24F3N3O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 126360741 |
| Molecular Formula | C20H24F3N3O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [(3R,3aR,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(3-nitrophenyl)methanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)c3cccc([N+](=O)[O-])c3)[C@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C20H24F3N3O4/c1-4-18(2,3)13-8-9-16-15(11-13)19(28,20(21,22)23)25(24-16)17(27)12-6-5-7-14(10-12)26(29)30/h5-7,10,13,15,28H,4,8-9,11H2,1-3H3/t13-,15-,19-/m1/s1 |
| InChIKey | BNIYEYUZFRGUBR-ZXYWRSMDSA-N |
| XLogP | 4.51 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|