C18H22F3N3O2 — CID 126107562
[(3R,3aR,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-pyridin-3-ylmethanone (PubChem CID 126107562) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is [(3R,3aR,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R,3aR,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 126107562 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(3R,3aR,5R)-5-tert-butyl-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-pyridin-3-ylmethanone |
| SMILES | CC(C)(C)[C@@H]1CCC2=NN(C(=O)c3cccnc3)[C@](O)(C(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-16(2,3)12-6-7-14-13(9-12)17(26,18(19,20)21)24(23-14)15(25)11-5-4-8-22-10-11/h4-5,8,10,12-13,26H,6-7,9H2,1-3H3/t12-,13-,17-/m1/s1 |
| InChIKey | SCWOWPMWTRLJEG-PBFPGSCMSA-N |
| XLogP | 3.61 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |