C24H33F3N2O2 — CID 126358179
[(3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-tert-butylphenyl)methanone (PubChem CID 126358179) has the molecular formula C24H33F3N2O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is [(3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-tert-butylphenyl)methanone.
| Compound Name | [(3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-tert-butylphenyl)methanone |
|---|---|
| PubChem CID | 126358179 |
| Molecular Formula | C24H33F3N2O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [(3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(4-tert-butylphenyl)methanone |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)c3ccc(C(C)(C)C)cc3)[C@@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C24H33F3N2O2/c1-7-22(5,6)17-12-13-19-18(14-17)23(31,24(25,26)27)29(28-19)20(30)15-8-10-16(11-9-15)21(2,3)4/h8-11,17-18,31H,7,12-14H2,1-6H3/t17-,18+,23+/m1/s1 |
| InChIKey | DEKHUCXCUOCCPU-STSQHVNTSA-N |
| XLogP | 5.90 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |