C18H29F3N2O3 — CID 126366961
tert-butyl (3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate (PubChem CID 126366961) has the molecular formula C18H29F3N2O3 and a molecular weight of 378.44 g/mol. Its IUPAC name is tert-butyl (3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate.
| Compound Name | tert-butyl (3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate |
|---|---|
| PubChem CID | 126366961 |
| Molecular Formula | C18H29F3N2O3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | tert-butyl (3S,3aS,5R)-3-hydroxy-5-(2-methylbutan-2-yl)-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazole-2-carboxylate |
| SMILES | CCC(C)(C)[C@@H]1CCC2=NN(C(=O)OC(C)(C)C)[C@@](O)(C(F)(F)F)[C@H]2C1 |
| InChI | InChI=1S/C18H29F3N2O3/c1-7-16(5,6)11-8-9-13-12(10-11)17(25,18(19,20)21)23(22-13)14(24)26-15(2,3)4/h11-12,25H,7-10H2,1-6H3/t11-,12+,17+/m1/s1 |
| InChIKey | RSQHNRCEXYEWSP-PEBVRCNWSA-N |
| XLogP | 4.70 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |