C15H23F3N2O3 — CID 5136387
tert-butyl 3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate (PubChem CID 5136387) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is tert-butyl 3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 5136387 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl 3-cyclohexyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1N=C(C2CCCCC2)CC1(O)C(F)(F)F |
| InChI | InChI=1S/C15H23F3N2O3/c1-13(2,3)23-12(21)20-14(22,15(16,17)18)9-11(19-20)10-7-5-4-6-8-10/h10,22H,4-9H2,1-3H3 |
| InChIKey | NZIYZKGSBGLCME-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |