C13H21F3N2O3 — CID 41165217
tert-butyl (5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate (PubChem CID 41165217) has the molecular formula C13H21F3N2O3 and a molecular weight of 310.32 g/mol. Its IUPAC name is tert-butyl (5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate.
| Compound Name | tert-butyl (5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 41165217 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl (5R)-3-butyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
| SMILES | CCCCC1=NN(C(=O)OC(C)(C)C)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H21F3N2O3/c1-5-6-7-9-8-12(20,13(14,15)16)18(17-9)10(19)21-11(2,3)4/h20H,5-8H2,1-4H3/t12-/m1/s1 |
| InChIKey | XHVSSBRSGMGNPB-GFCCVEGCSA-N |
| XLogP | 3.42 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |