C12H19F3N2O3 — CID 768878
tert-butyl (5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate (PubChem CID 768878) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is tert-butyl (5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 768878 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | tert-butyl (5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carboxylate |
| SMILES | CC(C)C1=NN(C(=O)OC(C)(C)C)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-7(2)8-6-11(19,12(13,14)15)17(16-8)9(18)20-10(3,4)5/h7,19H,6H2,1-5H3/t11-/m0/s1 |
| InChIKey | HWJLGPRYYNTCPK-NSHDSACASA-N |
| XLogP | 2.89 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |