C8H11F3N2OS — CID 143062455
5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carbothialdehyde (PubChem CID 143062455) has the molecular formula C8H11F3N2OS and a molecular weight of 240.25 g/mol. Its IUPAC name is 5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carbothialdehyde.
| Compound Name | 5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carbothialdehyde |
|---|---|
| PubChem CID | 143062455 |
| Molecular Formula | C8H11F3N2OS |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazole-1-carbothialdehyde |
| SMILES | CC(C)C1=NN(C=S)C(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H11F3N2OS/c1-5(2)6-3-7(14,8(9,10)11)13(4-15)12-6/h4-5,14H,3H2,1-2H3 |
| InChIKey | ZJORAGQDTSUIEQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|