C6H8F3N3OS — CID 4243342
5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide (PubChem CID 4243342) has the molecular formula C6H8F3N3OS and a molecular weight of 227.21 g/mol. Its IUPAC name is 5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide.
| Compound Name | 5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 4243342 |
| Molecular Formula | C6H8F3N3OS |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide |
| SMILES | CC1=NN(C(N)=S)C(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C6H8F3N3OS/c1-3-2-5(13,6(7,8)9)12(11-3)4(10)14/h13H,2H2,1H3,(H2,10,14) |
| InChIKey | UACDIZUBLQBJEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|