C11H10F3N3OS — CID 51663168
(5R)-5-hydroxy-3-phenyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide (PubChem CID 51663168) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is (5R)-5-hydroxy-3-phenyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide.
| Compound Name | (5R)-5-hydroxy-3-phenyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 51663168 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (5R)-5-hydroxy-3-phenyl-5-(trifluoromethyl)-4H-pyrazole-1-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccccc2)C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C11H10F3N3OS/c12-11(13,14)10(18)6-8(16-17(10)9(15)19)7-4-2-1-3-5-7/h1-5,18H,6H2,(H2,15,19)/t10-/m1/s1 |
| InChIKey | PQWOMPWOUBNGJD-SNVBAGLBSA-N |
| XLogP | 1.59 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|