C11H15F3N2O2 — CID 6940824
cyclopropyl-[(5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (PubChem CID 6940824) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is cyclopropyl-[(5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone.
| Compound Name | cyclopropyl-[(5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 6940824 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | cyclopropyl-[(5S)-5-hydroxy-3-propan-2-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone |
| SMILES | CC(C)C1=NN(C(=O)C2CC2)[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O2/c1-6(2)8-5-10(18,11(12,13)14)16(15-8)9(17)7-3-4-7/h6-7,18H,3-5H2,1-2H3/t10-/m0/s1 |
| InChIKey | WDRBULQQYUASIL-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |