C13H24F3NO4Si — CID 57272660
tert-butyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 57272660) has the molecular formula C13H24F3NO4Si and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57272660 |
| Molecular Formula | C13H24F3NO4Si |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | tert-butyl (4S,5S)-4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1N(C(=O)OC(C)(C)C)CO[C@@]1(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H24F3NO4Si/c1-9-12(13(14,15)16,21-22(5,6)7)19-8-17(9)10(18)20-11(2,3)4/h9H,8H2,1-7H3/t9-,12-/m0/s1 |
| InChIKey | XYXNUVHXENMULV-CABZTGNLSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|