C16H17F5N2O3 — CID 126339975
tert-butyl (5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazole-1-carboxylate (PubChem CID 126339975) has the molecular formula C16H17F5N2O3 and a molecular weight of 380.31 g/mol. Its IUPAC name is tert-butyl (5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazole-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 126339975 |
| Molecular Formula | C16H17F5N2O3 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | tert-butyl (5S)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1N=C(c2ccccc2)C[C@]1(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F5N2O3/c1-13(2,3)26-12(24)23-14(25,15(17,18)16(19,20)21)9-11(22-23)10-7-5-4-6-8-10/h4-8,25H,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | DMDVKXVEDUJROQ-AWEZNQCLSA-N |
| XLogP | 3.92 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|