C21H17F7N2O3 — CID 27136653
(2S)-1-[(5S)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-(4-methylphenyl)-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone (PubChem CID 27136653) has the molecular formula C21H17F7N2O3 and a molecular weight of 478.36 g/mol. Its IUPAC name is (2S)-1-[(5S)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-(4-methylphenyl)-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone.
| Compound Name | (2S)-1-[(5S)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-(4-methylphenyl)-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 27136653 |
| Molecular Formula | C21H17F7N2O3 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (2S)-1-[(5S)-5-(1,1,2,2,3,3,3-heptafluoropropyl)-5-hydroxy-3-(4-methylphenyl)-4H-pyrazol-1-yl]-2-hydroxy-2-phenylethanone |
| SMILES | Cc1ccc(C2=NN(C(=O)[C@@H](O)c3ccccc3)[C@@](O)(C(F)(F)C(F)(F)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C21H17F7N2O3/c1-12-7-9-13(10-8-12)15-11-18(33,19(22,23)20(24,25)21(26,27)28)30(29-15)17(32)16(31)14-5-3-2-4-6-14/h2-10,16,31,33H,11H2,1H3/t16-,18-/m0/s1 |
| InChIKey | OWYSSQBWMTYQNI-WMZOPIPTSA-N |
| XLogP | 4.19 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|